C13H20N4O4 — CID 155456522
tert-butyl N-(2-amino-4-carbamoyl-6-methoxyanilino)carbamate (PubChem CID 155456522) has the molecular formula C13H20N4O4 and a molecular weight of 296.33 g/mol. Its IUPAC name is tert-butyl N-(2-amino-4-carbamoyl-6-methoxyanilino)carbamate.
| Compound Name | tert-butyl N-(2-amino-4-carbamoyl-6-methoxyanilino)carbamate |
|---|---|
| PubChem CID | 155456522 |
| Molecular Formula | C13H20N4O4 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | tert-butyl N-(2-amino-4-carbamoyl-6-methoxyanilino)carbamate |
| SMILES | COc1cc(C(N)=O)cc(N)c1NNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H20N4O4/c1-13(2,3)21-12(19)17-16-10-8(14)5-7(11(15)18)6-9(10)20-4/h5-6,16H,14H2,1-4H3,(H2,15,18)(H,17,19) |
| InChIKey | JLFDXJYOEZSCCD-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 128.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|