C16H24N4O6 — CID 148838118
tert-butyl N-[3-(4-carbamoyl-2-methoxy-6-nitroanilino)propyl]carbamate (PubChem CID 148838118) has the molecular formula C16H24N4O6 and a molecular weight of 368.39 g/mol. Its IUPAC name is tert-butyl N-[3-(4-carbamoyl-2-methoxy-6-nitroanilino)propyl]carbamate.
| Compound Name | tert-butyl N-[3-(4-carbamoyl-2-methoxy-6-nitroanilino)propyl]carbamate |
|---|---|
| PubChem CID | 148838118 |
| Molecular Formula | C16H24N4O6 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | tert-butyl N-[3-(4-carbamoyl-2-methoxy-6-nitroanilino)propyl]carbamate |
| SMILES | COc1cc(C(N)=O)cc([N+](=O)[O-])c1NCCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H24N4O6/c1-16(2,3)26-15(22)19-7-5-6-18-13-11(20(23)24)8-10(14(17)21)9-12(13)25-4/h8-9,18H,5-7H2,1-4H3,(H2,17,21)(H,19,22) |
| InChIKey | OUZNEGHUXCFOAM-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 145.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|