C16H22BrN3O6 — CID 171118409
methyl 5-bromo-2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylamino]-3-nitrobenzoate (PubChem CID 171118409) has the molecular formula C16H22BrN3O6 and a molecular weight of 432.27 g/mol. Its IUPAC name is methyl 5-bromo-2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylamino]-3-nitrobenzoate.
| Compound Name | methyl 5-bromo-2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylamino]-3-nitrobenzoate |
|---|---|
| PubChem CID | 171118409 |
| Molecular Formula | C16H22BrN3O6 |
| Molecular Weight | 432.27 g/mol |
| Exact Mass | 431.07 |
| IUPAC Name | methyl 5-bromo-2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylamino]-3-nitrobenzoate |
| SMILES | COC(=O)c1cc(Br)cc([N+](=O)[O-])c1NCCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H22BrN3O6/c1-16(2,3)26-15(22)19-7-5-6-18-13-11(14(21)25-4)8-10(17)9-12(13)20(23)24/h8-9,18H,5-7H2,1-4H3,(H,19,22) |
| InChIKey | UBUYKQPCJOONAI-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.27 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|