C15H24N4O6 — CID 162731209
methyl 1-[5-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl]-4-nitropyrazole-5-carboxylate (PubChem CID 162731209) has the molecular formula C15H24N4O6 and a molecular weight of 356.38 g/mol. Its IUPAC name is methyl 1-[5-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl]-4-nitropyrazole-5-carboxylate.
| Compound Name | methyl 1-[5-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl]-4-nitropyrazole-5-carboxylate |
|---|---|
| PubChem CID | 162731209 |
| Molecular Formula | C15H24N4O6 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | methyl 1-[5-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl]-4-nitropyrazole-5-carboxylate |
| SMILES | COC(=O)c1c([N+](=O)[O-])cnn1CCCCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H24N4O6/c1-15(2,3)25-14(21)16-8-6-5-7-9-18-12(13(20)24-4)11(10-17-18)19(22)23/h10H,5-9H2,1-4H3,(H,16,21) |
| InChIKey | XAMJKOOXLBAMNC-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 125.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|