C13H21N5O4 — CID 58465101
tert-butyl N-[3-(7-nitro-2,3-dihydroimidazo[2,1-e]pyrazol-1-yl)propyl]carbamate (PubChem CID 58465101) has the molecular formula C13H21N5O4 and a molecular weight of 311.34 g/mol. Its IUPAC name is tert-butyl N-[3-(7-nitro-2,3-dihydroimidazo[2,1-e]pyrazol-1-yl)propyl]carbamate.
| Compound Name | tert-butyl N-[3-(7-nitro-2,3-dihydroimidazo[2,1-e]pyrazol-1-yl)propyl]carbamate |
|---|---|
| PubChem CID | 58465101 |
| Molecular Formula | C13H21N5O4 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | tert-butyl N-[3-(7-nitro-2,3-dihydroimidazo[2,1-e]pyrazol-1-yl)propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCN1CCn2ncc([N+](=O)[O-])c21 |
| InChI | InChI=1S/C13H21N5O4/c1-13(2,3)22-12(19)14-5-4-6-16-7-8-17-11(16)10(9-15-17)18(20)21/h9H,4-8H2,1-3H3,(H,14,19) |
| InChIKey | DHRLXGUMUQOKQW-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 102.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|