C13H20ClN3O5 — CID 153367840
tert-butyl N-[3-(4-carbonochloridoyl-2,3-dioxopiperazin-1-yl)propyl]carbamate (PubChem CID 153367840) has the molecular formula C13H20ClN3O5 and a molecular weight of 333.77 g/mol. Its IUPAC name is tert-butyl N-[3-(4-carbonochloridoyl-2,3-dioxopiperazin-1-yl)propyl]carbamate.
| Compound Name | tert-butyl N-[3-(4-carbonochloridoyl-2,3-dioxopiperazin-1-yl)propyl]carbamate |
|---|---|
| PubChem CID | 153367840 |
| Molecular Formula | C13H20ClN3O5 |
| Molecular Weight | 333.77 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | tert-butyl N-[3-(4-carbonochloridoyl-2,3-dioxopiperazin-1-yl)propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCN1CCN(C(=O)Cl)C(=O)C1=O |
| InChI | InChI=1S/C13H20ClN3O5/c1-13(2,3)22-12(21)15-5-4-6-16-7-8-17(11(14)20)10(19)9(16)18/h4-8H2,1-3H3,(H,15,21) |
| InChIKey | NJTIGFMRRAFIQQ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.77 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|