C14H24N2O5 — CID 153361350
methyl 1-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-5-oxopyrrolidine-2-carboxylate (PubChem CID 153361350) has the molecular formula C14H24N2O5 and a molecular weight of 300.35 g/mol. Its IUPAC name is methyl 1-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-5-oxopyrrolidine-2-carboxylate.
| Compound Name | methyl 1-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-5-oxopyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 153361350 |
| Molecular Formula | C14H24N2O5 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | methyl 1-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-5-oxopyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1CCC(=O)N1CCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H24N2O5/c1-14(2,3)21-13(19)15-8-5-9-16-10(12(18)20-4)6-7-11(16)17/h10H,5-9H2,1-4H3,(H,15,19) |
| InChIKey | HPOVBJLFTFVZHX-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|