About methyl (2S)-1-(cyanomethyl)-5-oxopyrrolidine-2-carboxylate;sulfane
methyl (2S)-1-(cyanomethyl)-5-oxopyrrolidine-2-carboxylate;sulfane (PubChem CID 158958204) has the molecular formula C8H12N2O3S
and a molecular weight of 216.26 g/mol. Its IUPAC name is methyl (2S)-1-(cyanomethyl)-5-oxopyrrolidine-2-carboxylate;sulfane.
Molecular Properties
| Compound Name | methyl (2S)-1-(cyanomethyl)-5-oxopyrrolidine-2-carboxylate;sulfane |
| PubChem CID | 158958204 |
| Molecular Formula | C8H12N2O3S |
| Molecular Weight | 216.26 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | methyl (2S)-1-(cyanomethyl)-5-oxopyrrolidine-2-carboxylate;sulfane |
| SMILES | COC(=O)[C@@H]1CCC(=O)N1CC#N.S |
| InChI | InChI=1S/C8H10N2O3.H2S/c1-13-8(12)6-2-3-7(11)10(6)5-4-9;/h6H,2-3,5H2,1H3;1H2/t6-;/m0./s1 |
| InChIKey | JMGZAKWVNGMNSZ-RGMNGODLSA-N |
| XLogP | -0.21 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.26 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|
Analyze methyl (2S)-1-(cyanomethyl)-5-oxopyrrolidine-2-carboxylate;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S)-1-(cyanomethyl)-5-oxopyrrolidine-2-carboxylate;sulfane?
The IUPAC name of methyl (2S)-1-(cyanomethyl)-5-oxopyrrolidine-2-carboxylate;sulfane (CID 158958204) is methyl (2S)-1-(cyanomethyl)-5-oxopyrrolidine-2-carboxylate;sulfane.
What is the SMILES notation for methyl (2S)-1-(cyanomethyl)-5-oxopyrrolidine-2-carboxylate;sulfane?
The canonical SMILES for methyl (2S)-1-(cyanomethyl)-5-oxopyrrolidine-2-carboxylate;sulfane is COC(=O)[C@@H]1CCC(=O)N1CC#N.S.
What is the InChIKey of methyl (2S)-1-(cyanomethyl)-5-oxopyrrolidine-2-carboxylate;sulfane?
The InChIKey is JMGZAKWVNGMNSZ-RGMNGODLSA-N. The full InChI is InChI=1S/C8H10N2O3.H2S/c1-13-8(12)6-2-3-7(11)10(6)5-4-9;/h6H,2-3,5H2,1H3;1H2/t6-;/m0./s1.
What are the key properties of methyl (2S)-1-(cyanomethyl)-5-oxopyrrolidine-2-carboxylate;sulfane?
methyl (2S)-1-(cyanomethyl)-5-oxopyrrolidine-2-carboxylate;sulfane has a molecular weight of 216.26 g/mol, XLogP of -0.21, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-1-(cyanomethyl)-5-oxopyrrolidine-2-carboxylate;sulfane is sourced from PubChem (CID 158958204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).