C13H13Br2NO5 — CID 102351523
methyl (2S)-1-[(2,3-dibromo-4,5-dihydroxyphenyl)methyl]-5-oxopyrrolidine-2-carboxylate (PubChem CID 102351523) has the molecular formula C13H13Br2NO5 and a molecular weight of 423.06 g/mol. Its IUPAC name is methyl (2S)-1-[(2,3-dibromo-4,5-dihydroxyphenyl)methyl]-5-oxopyrrolidine-2-carboxylate.
| Compound Name | methyl (2S)-1-[(2,3-dibromo-4,5-dihydroxyphenyl)methyl]-5-oxopyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 102351523 |
| Molecular Formula | C13H13Br2NO5 |
| Molecular Weight | 423.06 g/mol |
| Exact Mass | 420.92 |
| IUPAC Name | methyl (2S)-1-[(2,3-dibromo-4,5-dihydroxyphenyl)methyl]-5-oxopyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1CCC(=O)N1Cc1cc(O)c(O)c(Br)c1Br |
| InChI | InChI=1S/C13H13Br2NO5/c1-21-13(20)7-2-3-9(18)16(7)5-6-4-8(17)12(19)11(15)10(6)14/h4,7,17,19H,2-3,5H2,1H3/t7-/m0/s1 |
| InChIKey | ARCCBVHXHHINEZ-ZETCQYMHSA-N |
| XLogP | 2.29 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.06 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|