C7H11NO4 — CID 13458635
methyl 1-(hydroxymethyl)-5-oxopyrrolidine-2-carboxylate (PubChem CID 13458635) has the molecular formula C7H11NO4 and a molecular weight of 173.17 g/mol. Its IUPAC name is methyl 1-(hydroxymethyl)-5-oxopyrrolidine-2-carboxylate.
| Compound Name | methyl 1-(hydroxymethyl)-5-oxopyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 13458635 |
| Molecular Formula | C7H11NO4 |
| Molecular Weight | 173.17 g/mol |
| Exact Mass | 173.07 |
| IUPAC Name | methyl 1-(hydroxymethyl)-5-oxopyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1CCC(=O)N1CO |
| InChI | InChI=1S/C7H11NO4/c1-12-7(11)5-2-3-6(10)8(5)4-9/h5,9H,2-4H2,1H3 |
| InChIKey | RRPWACRFLUDMIE-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.17 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |