About tert-butyl N-[2-[(2S)-2-(3-methoxy-2-methylbenzoyl)-5-oxopyrrolidin-1-yl]ethyl]carbamate;sulfane
tert-butyl N-[2-[(2S)-2-(3-methoxy-2-methylbenzoyl)-5-oxopyrrolidin-1-yl]ethyl]carbamate;sulfane (PubChem CID 159459909) has the molecular formula C20H30N2O5S
and a molecular weight of 410.54 g/mol. Its IUPAC name is tert-butyl N-[2-[(2S)-2-(3-methoxy-2-methylbenzoyl)-5-oxopyrrolidin-1-yl]ethyl]carbamate;sulfane.
Molecular Properties
| Compound Name | tert-butyl N-[2-[(2S)-2-(3-methoxy-2-methylbenzoyl)-5-oxopyrrolidin-1-yl]ethyl]carbamate;sulfane |
| PubChem CID | 159459909 |
| Molecular Formula | C20H30N2O5S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | tert-butyl N-[2-[(2S)-2-(3-methoxy-2-methylbenzoyl)-5-oxopyrrolidin-1-yl]ethyl]carbamate;sulfane |
| SMILES | COc1cccc(C(=O)[C@@H]2CCC(=O)N2CCNC(=O)OC(C)(C)C)c1C.S |
| InChI | InChI=1S/C20H28N2O5.H2S/c1-13-14(7-6-8-16(13)26-5)18(24)15-9-10-17(23)22(15)12-11-21-19(25)27-20(2,3)4;/h6-8,15H,9-12H2,1-5H3,(H,21,25);1H2/t15-;/m0./s1 |
| InChIKey | LULPCFTXVIIFEC-RSAXXLAASA-N |
| XLogP | 2.81 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl N-[2-[(2S)-2-(3-methoxy-2-methylbenzoyl)-5-oxopyrrolidin-1-yl]ethyl]carbamate;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[2-[(2S)-2-(3-methoxy-2-methylbenzoyl)-5-oxopyrrolidin-1-yl]ethyl]carbamate;sulfane?
The IUPAC name of tert-butyl N-[2-[(2S)-2-(3-methoxy-2-methylbenzoyl)-5-oxopyrrolidin-1-yl]ethyl]carbamate;sulfane (CID 159459909) is tert-butyl N-[2-[(2S)-2-(3-methoxy-2-methylbenzoyl)-5-oxopyrrolidin-1-yl]ethyl]carbamate;sulfane.
What is the SMILES notation for tert-butyl N-[2-[(2S)-2-(3-methoxy-2-methylbenzoyl)-5-oxopyrrolidin-1-yl]ethyl]carbamate;sulfane?
The canonical SMILES for tert-butyl N-[2-[(2S)-2-(3-methoxy-2-methylbenzoyl)-5-oxopyrrolidin-1-yl]ethyl]carbamate;sulfane is COc1cccc(C(=O)[C@@H]2CCC(=O)N2CCNC(=O)OC(C)(C)C)c1C.S.
What is the InChIKey of tert-butyl N-[2-[(2S)-2-(3-methoxy-2-methylbenzoyl)-5-oxopyrrolidin-1-yl]ethyl]carbamate;sulfane?
The InChIKey is LULPCFTXVIIFEC-RSAXXLAASA-N. The full InChI is InChI=1S/C20H28N2O5.H2S/c1-13-14(7-6-8-16(13)26-5)18(24)15-9-10-17(23)22(15)12-11-21-19(25)27-20(2,3)4;/h6-8,15H,9-12H2,1-5H3,(H,21,25);1H2/t15-;/m0./s1.
What are the key properties of tert-butyl N-[2-[(2S)-2-(3-methoxy-2-methylbenzoyl)-5-oxopyrrolidin-1-yl]ethyl]carbamate;sulfane?
tert-butyl N-[2-[(2S)-2-(3-methoxy-2-methylbenzoyl)-5-oxopyrrolidin-1-yl]ethyl]carbamate;sulfane has a molecular weight of 410.54 g/mol, XLogP of 2.81, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[2-[(2S)-2-(3-methoxy-2-methylbenzoyl)-5-oxopyrrolidin-1-yl]ethyl]carbamate;sulfane is sourced from PubChem (CID 159459909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).