C14H22ClN3O5 — CID 166142501
tert-butyl N-[3-(4-carbonochloridoyl-2,3-dioxopiperazin-1-yl)propyl]-N-methylcarbamate (PubChem CID 166142501) has the molecular formula C14H22ClN3O5 and a molecular weight of 347.80 g/mol. Its IUPAC name is tert-butyl N-[3-(4-carbonochloridoyl-2,3-dioxopiperazin-1-yl)propyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[3-(4-carbonochloridoyl-2,3-dioxopiperazin-1-yl)propyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 166142501 |
| Molecular Formula | C14H22ClN3O5 |
| Molecular Weight | 347.80 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | tert-butyl N-[3-(4-carbonochloridoyl-2,3-dioxopiperazin-1-yl)propyl]-N-methylcarbamate |
| SMILES | CN(CCCN1CCN(C(=O)Cl)C(=O)C1=O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H22ClN3O5/c1-14(2,3)23-13(22)16(4)6-5-7-17-8-9-18(12(15)21)11(20)10(17)19/h5-9H2,1-4H3 |
| InChIKey | KPALYXONSDKNMY-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.80 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|