C16H31N3O4 — CID 100654184
tert-butyl N-[3-[4-(2-methoxyacetyl)piperazin-1-yl]propyl]-N-methylcarbamate (PubChem CID 100654184) has the molecular formula C16H31N3O4 and a molecular weight of 329.44 g/mol. Its IUPAC name is tert-butyl N-[3-[4-(2-methoxyacetyl)piperazin-1-yl]propyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[3-[4-(2-methoxyacetyl)piperazin-1-yl]propyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 100654184 |
| Molecular Formula | C16H31N3O4 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.23 |
| IUPAC Name | tert-butyl N-[3-[4-(2-methoxyacetyl)piperazin-1-yl]propyl]-N-methylcarbamate |
| SMILES | COCC(=O)N1CCN(CCCN(C)C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C16H31N3O4/c1-16(2,3)23-15(21)17(4)7-6-8-18-9-11-19(12-10-18)14(20)13-22-5/h6-13H2,1-5H3 |
| InChIKey | LPBJPFXIGCFZBZ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |