C20H41N3O2 — CID 121362451
tert-butyl 4-[3-[bis(2-methylpropyl)amino]propyl]piperazine-1-carboxylate (PubChem CID 121362451) has the molecular formula C20H41N3O2 and a molecular weight of 355.57 g/mol. Its IUPAC name is tert-butyl 4-[3-[bis(2-methylpropyl)amino]propyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[bis(2-methylpropyl)amino]propyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 121362451 |
| Molecular Formula | C20H41N3O2 |
| Molecular Weight | 355.57 g/mol |
| Exact Mass | 355.32 |
| IUPAC Name | tert-butyl 4-[3-[bis(2-methylpropyl)amino]propyl]piperazine-1-carboxylate |
| SMILES | CC(C)CN(CCCN1CCN(C(=O)OC(C)(C)C)CC1)CC(C)C |
| InChI | InChI=1S/C20H41N3O2/c1-17(2)15-22(16-18(3)4)10-8-9-21-11-13-23(14-12-21)19(24)25-20(5,6)7/h17-18H,8-16H2,1-7H3 |
| InChIKey | OSBTVYAQGOXYLT-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.57 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |