C15H29F2N3O2 — CID 107243499
tert-butyl 4-[3-(1,1-difluoropropan-2-ylamino)propyl]piperazine-1-carboxylate (PubChem CID 107243499) has the molecular formula C15H29F2N3O2 and a molecular weight of 321.41 g/mol. Its IUPAC name is tert-butyl 4-[3-(1,1-difluoropropan-2-ylamino)propyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-(1,1-difluoropropan-2-ylamino)propyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 107243499 |
| Molecular Formula | C15H29F2N3O2 |
| Molecular Weight | 321.41 g/mol |
| Exact Mass | 321.22 |
| IUPAC Name | tert-butyl 4-[3-(1,1-difluoropropan-2-ylamino)propyl]piperazine-1-carboxylate |
| SMILES | CC(NCCCN1CCN(C(=O)OC(C)(C)C)CC1)C(F)F |
| InChI | InChI=1S/C15H29F2N3O2/c1-12(13(16)17)18-6-5-7-19-8-10-20(11-9-19)14(21)22-15(2,3)4/h12-13,18H,5-11H2,1-4H3 |
| InChIKey | VFWOQTAWVTUGNH-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.41 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|