C15H28F2N2O3 — CID 107252356
tert-butyl 4-[2-(1,1-difluoropropan-2-ylamino)ethoxy]piperidine-1-carboxylate (PubChem CID 107252356) has the molecular formula C15H28F2N2O3 and a molecular weight of 322.40 g/mol. Its IUPAC name is tert-butyl 4-[2-(1,1-difluoropropan-2-ylamino)ethoxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(1,1-difluoropropan-2-ylamino)ethoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 107252356 |
| Molecular Formula | C15H28F2N2O3 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | tert-butyl 4-[2-(1,1-difluoropropan-2-ylamino)ethoxy]piperidine-1-carboxylate |
| SMILES | CC(NCCOC1CCN(C(=O)OC(C)(C)C)CC1)C(F)F |
| InChI | InChI=1S/C15H28F2N2O3/c1-11(13(16)17)18-7-10-21-12-5-8-19(9-6-12)14(20)22-15(2,3)4/h11-13,18H,5-10H2,1-4H3 |
| InChIKey | RBEAUUIVDJIEOW-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|