C16H32N2O3S — CID 107252389
tert-butyl 4-[2-(3-methylsulfanylpropylamino)ethoxy]piperidine-1-carboxylate (PubChem CID 107252389) has the molecular formula C16H32N2O3S and a molecular weight of 332.51 g/mol. Its IUPAC name is tert-butyl 4-[2-(3-methylsulfanylpropylamino)ethoxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(3-methylsulfanylpropylamino)ethoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 107252389 |
| Molecular Formula | C16H32N2O3S |
| Molecular Weight | 332.51 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | tert-butyl 4-[2-(3-methylsulfanylpropylamino)ethoxy]piperidine-1-carboxylate |
| SMILES | CSCCCNCCOC1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C16H32N2O3S/c1-16(2,3)21-15(19)18-10-6-14(7-11-18)20-12-9-17-8-5-13-22-4/h14,17H,5-13H2,1-4H3 |
| InChIKey | UFGWMVKYADOHRF-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.51 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|