C18H37N3O3 — CID 112753939
tert-butyl 4-[3-[(3-amino-3-methylbutyl)amino]propoxy]piperidine-1-carboxylate (PubChem CID 112753939) has the molecular formula C18H37N3O3 and a molecular weight of 343.51 g/mol. Its IUPAC name is tert-butyl 4-[3-[(3-amino-3-methylbutyl)amino]propoxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[(3-amino-3-methylbutyl)amino]propoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 112753939 |
| Molecular Formula | C18H37N3O3 |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.28 |
| IUPAC Name | tert-butyl 4-[3-[(3-amino-3-methylbutyl)amino]propoxy]piperidine-1-carboxylate |
| SMILES | CC(C)(N)CCNCCCOC1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C18H37N3O3/c1-17(2,3)24-16(22)21-12-7-15(8-13-21)23-14-6-10-20-11-9-18(4,5)19/h15,20H,6-14,19H2,1-5H3 |
| InChIKey | ZEPFLGQWXDONAU-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|