C17H32N2O4 — CID 90841489
tert-butyl 4-[(4-acetyloxybutylamino)methyl]piperidine-1-carboxylate (PubChem CID 90841489) has the molecular formula C17H32N2O4 and a molecular weight of 328.45 g/mol. Its IUPAC name is tert-butyl 4-[(4-acetyloxybutylamino)methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(4-acetyloxybutylamino)methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 90841489 |
| Molecular Formula | C17H32N2O4 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | tert-butyl 4-[(4-acetyloxybutylamino)methyl]piperidine-1-carboxylate |
| SMILES | CC(=O)OCCCCNCC1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C17H32N2O4/c1-14(20)22-12-6-5-9-18-13-15-7-10-19(11-8-15)16(21)23-17(2,3)4/h15,18H,5-13H2,1-4H3 |
| InChIKey | XARQRFBXRAASRT-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|