C19H37N3O4 — CID 55867055
tert-butyl 4-[3-[3-(2-methylpropoxy)propanoylamino]propyl]piperazine-1-carboxylate (PubChem CID 55867055) has the molecular formula C19H37N3O4 and a molecular weight of 371.52 g/mol. Its IUPAC name is tert-butyl 4-[3-[3-(2-methylpropoxy)propanoylamino]propyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[3-(2-methylpropoxy)propanoylamino]propyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 55867055 |
| Molecular Formula | C19H37N3O4 |
| Molecular Weight | 371.52 g/mol |
| Exact Mass | 371.28 |
| IUPAC Name | tert-butyl 4-[3-[3-(2-methylpropoxy)propanoylamino]propyl]piperazine-1-carboxylate |
| SMILES | CC(C)COCCC(=O)NCCCN1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C19H37N3O4/c1-16(2)15-25-14-7-17(23)20-8-6-9-21-10-12-22(13-11-21)18(24)26-19(3,4)5/h16H,6-15H2,1-5H3,(H,20,23) |
| InChIKey | YEFYGTMWBXQDNZ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.52 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|