C15H21N3O7 — CID 159405192
tert-butyl N-[3-[(6-methyl-3-nitro-2-pyridinyl)oxy]propyl]carbamate;carbon dioxide (PubChem CID 159405192) has the molecular formula C15H21N3O7 and a molecular weight of 355.35 g/mol. Its IUPAC name is tert-butyl N-[3-[(6-methyl-3-nitro-2-pyridinyl)oxy]propyl]carbamate;carbon dioxide.
| Compound Name | tert-butyl N-[3-[(6-methyl-3-nitro-2-pyridinyl)oxy]propyl]carbamate;carbon dioxide |
|---|---|
| PubChem CID | 159405192 |
| Molecular Formula | C15H21N3O7 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | tert-butyl N-[3-[(6-methyl-3-nitro-2-pyridinyl)oxy]propyl]carbamate;carbon dioxide |
| SMILES | Cc1ccc([N+](=O)[O-])c(OCCCNC(=O)OC(C)(C)C)n1.O=C=O |
| InChI | InChI=1S/C14H21N3O5.CO2/c1-10-6-7-11(17(19)20)12(16-10)21-9-5-8-15-13(18)22-14(2,3)4;2-1-3/h6-7H,5,8-9H2,1-4H3,(H,15,18); |
| InChIKey | LNWCMIHTEZJIPM-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 137.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|