C21H37N5O4 — CID 68799850
tert-butyl N-[3-[[6-[bis(2-methylpropyl)amino]-3-nitro-2-pyridinyl]amino]propyl]carbamate (PubChem CID 68799850) has the molecular formula C21H37N5O4 and a molecular weight of 423.56 g/mol. Its IUPAC name is tert-butyl N-[3-[[6-[bis(2-methylpropyl)amino]-3-nitro-2-pyridinyl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[6-[bis(2-methylpropyl)amino]-3-nitro-2-pyridinyl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 68799850 |
| Molecular Formula | C21H37N5O4 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.28 |
| IUPAC Name | tert-butyl N-[3-[[6-[bis(2-methylpropyl)amino]-3-nitro-2-pyridinyl]amino]propyl]carbamate |
| SMILES | CC(C)CN(CC(C)C)c1ccc([N+](=O)[O-])c(NCCCNC(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C21H37N5O4/c1-15(2)13-25(14-16(3)4)18-10-9-17(26(28)29)19(24-18)22-11-8-12-23-20(27)30-21(5,6)7/h9-10,15-16H,8,11-14H2,1-7H3,(H,22,24)(H,23,27) |
| InChIKey | BDFCJBYFIRAHIG-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 109.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|