C15H26N4O2 — CID 107818912
6-N-methyl-2-N-(7-methyloctyl)-3-nitropyridine-2,6-diamine (PubChem CID 107818912) has the molecular formula C15H26N4O2 and a molecular weight of 294.40 g/mol. Its IUPAC name is 6-N-methyl-2-N-(7-methyloctyl)-3-nitropyridine-2,6-diamine.
| Compound Name | 6-N-methyl-2-N-(7-methyloctyl)-3-nitropyridine-2,6-diamine |
|---|---|
| PubChem CID | 107818912 |
| Molecular Formula | C15H26N4O2 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | 6-N-methyl-2-N-(7-methyloctyl)-3-nitropyridine-2,6-diamine |
| SMILES | CNc1ccc([N+](=O)[O-])c(NCCCCCCC(C)C)n1 |
| InChI | InChI=1S/C15H26N4O2/c1-12(2)8-6-4-5-7-11-17-15-13(19(20)21)9-10-14(16-3)18-15/h9-10,12H,4-8,11H2,1-3H3,(H2,16,17,18) |
| InChIKey | LDMNMAIXDKEDDR-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 80.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|