C10H16N4O4S — CID 80811993
6-N-methyl-2-N-(3-methylsulfonylpropyl)-3-nitropyridine-2,6-diamine (PubChem CID 80811993) has the molecular formula C10H16N4O4S and a molecular weight of 288.33 g/mol. Its IUPAC name is 6-N-methyl-2-N-(3-methylsulfonylpropyl)-3-nitropyridine-2,6-diamine.
| Compound Name | 6-N-methyl-2-N-(3-methylsulfonylpropyl)-3-nitropyridine-2,6-diamine |
|---|---|
| PubChem CID | 80811993 |
| Molecular Formula | C10H16N4O4S |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 6-N-methyl-2-N-(3-methylsulfonylpropyl)-3-nitropyridine-2,6-diamine |
| SMILES | CNc1ccc([N+](=O)[O-])c(NCCCS(C)(=O)=O)n1 |
| InChI | InChI=1S/C10H16N4O4S/c1-11-9-5-4-8(14(15)16)10(13-9)12-6-3-7-19(2,17)18/h4-5H,3,6-7H2,1-2H3,(H2,11,12,13) |
| InChIKey | STKYJRQOHDLUEZ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 114.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|