C11H19N5O4S — CID 106332229
N-[3-[[6-(ethylamino)-3-nitro-2-pyridinyl]amino]propyl]methanesulfonamide (PubChem CID 106332229) has the molecular formula C11H19N5O4S and a molecular weight of 317.37 g/mol. Its IUPAC name is N-[3-[[6-(ethylamino)-3-nitro-2-pyridinyl]amino]propyl]methanesulfonamide.
| Compound Name | N-[3-[[6-(ethylamino)-3-nitro-2-pyridinyl]amino]propyl]methanesulfonamide |
|---|---|
| PubChem CID | 106332229 |
| Molecular Formula | C11H19N5O4S |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | N-[3-[[6-(ethylamino)-3-nitro-2-pyridinyl]amino]propyl]methanesulfonamide |
| SMILES | CCNc1ccc([N+](=O)[O-])c(NCCCNS(C)(=O)=O)n1 |
| InChI | InChI=1S/C11H19N5O4S/c1-3-12-10-6-5-9(16(17)18)11(15-10)13-7-4-8-14-21(2,19)20/h5-6,14H,3-4,7-8H2,1-2H3,(H2,12,13,15) |
| InChIKey | MTXLARWZJOSHAV-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 126.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|