C10H17N5O4S — CID 80787850
N-[2-[[6-(ethylamino)-3-nitro-2-pyridinyl]amino]ethyl]methanesulfonamide (PubChem CID 80787850) has the molecular formula C10H17N5O4S and a molecular weight of 303.34 g/mol. Its IUPAC name is N-[2-[[6-(ethylamino)-3-nitro-2-pyridinyl]amino]ethyl]methanesulfonamide.
| Compound Name | N-[2-[[6-(ethylamino)-3-nitro-2-pyridinyl]amino]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 80787850 |
| Molecular Formula | C10H17N5O4S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | N-[2-[[6-(ethylamino)-3-nitro-2-pyridinyl]amino]ethyl]methanesulfonamide |
| SMILES | CCNc1ccc([N+](=O)[O-])c(NCCNS(C)(=O)=O)n1 |
| InChI | InChI=1S/C10H17N5O4S/c1-3-11-9-5-4-8(15(16)17)10(14-9)12-6-7-13-20(2,18)19/h4-5,13H,3,6-7H2,1-2H3,(H2,11,12,14) |
| InChIKey | LLOOZTMDIODXDO-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 126.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|