C12H16N4O6 — CID 175091688
3-(4-carbamoyl-2-methoxy-6-nitroanilino)propyl carbamate (PubChem CID 175091688) has the molecular formula C12H16N4O6 and a molecular weight of 312.28 g/mol. Its IUPAC name is 3-(4-carbamoyl-2-methoxy-6-nitroanilino)propyl carbamate.
| Compound Name | 3-(4-carbamoyl-2-methoxy-6-nitroanilino)propyl carbamate |
|---|---|
| PubChem CID | 175091688 |
| Molecular Formula | C12H16N4O6 |
| Molecular Weight | 312.28 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 3-(4-carbamoyl-2-methoxy-6-nitroanilino)propyl carbamate |
| SMILES | COc1cc(C(N)=O)cc([N+](=O)[O-])c1NCCCOC(N)=O |
| InChI | InChI=1S/C12H16N4O6/c1-21-9-6-7(11(13)17)5-8(16(19)20)10(9)15-3-2-4-22-12(14)18/h5-6,15H,2-4H2,1H3,(H2,13,17)(H2,14,18) |
| InChIKey | SPFGBTAVLZBSRC-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 159.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.28 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|