C16H22N4O7 — CID 175148035
[(E)-4-[4-carbamoyl-2-(3-methoxypropoxy)-6-nitroanilino]but-2-enyl] carbamate (PubChem CID 175148035) has the molecular formula C16H22N4O7 and a molecular weight of 382.37 g/mol. Its IUPAC name is [(E)-4-[4-carbamoyl-2-(3-methoxypropoxy)-6-nitroanilino]but-2-enyl] carbamate.
| Compound Name | [(E)-4-[4-carbamoyl-2-(3-methoxypropoxy)-6-nitroanilino]but-2-enyl] carbamate |
|---|---|
| PubChem CID | 175148035 |
| Molecular Formula | C16H22N4O7 |
| Molecular Weight | 382.37 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | [(E)-4-[4-carbamoyl-2-(3-methoxypropoxy)-6-nitroanilino]but-2-enyl] carbamate |
| SMILES | COCCCOc1cc(C(N)=O)cc([N+](=O)[O-])c1NC/C=C/COC(N)=O |
| InChI | InChI=1S/C16H22N4O7/c1-25-6-4-8-26-13-10-11(15(17)21)9-12(20(23)24)14(13)19-5-2-3-7-27-16(18)22/h2-3,9-10,19H,4-8H2,1H3,(H2,17,21)(H2,18,22)/b3-2+ |
| InChIKey | KYTNYMASJIOFFE-NSCUHMNNSA-N |
| XLogP | 1.17 |
| TPSA | 169.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.37 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|