C31H43N7O8 — CID 176638323
tert-butyl 4-[3-[2-[[(E)-4-(2-amino-4-methoxycarbonylanilino)but-2-enyl]amino]-5-carbamoyl-3-nitrophenoxy]propyl]piperazine-1-carboxylate (PubChem CID 176638323) has the molecular formula C31H43N7O8 and a molecular weight of 641.73 g/mol. Its IUPAC name is tert-butyl 4-[3-[2-[[(E)-4-(2-amino-4-methoxycarbonylanilino)but-2-enyl]amino]-5-carbamoyl-3-nitrophenoxy]propyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[2-[[(E)-4-(2-amino-4-methoxycarbonylanilino)but-2-enyl]amino]-5-carbamoyl-3-nitrophenoxy]propyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 176638323 |
| Molecular Formula | C31H43N7O8 |
| Molecular Weight | 641.73 g/mol |
| Exact Mass | 641.32 |
| IUPAC Name | tert-butyl 4-[3-[2-[[(E)-4-(2-amino-4-methoxycarbonylanilino)but-2-enyl]amino]-5-carbamoyl-3-nitrophenoxy]propyl]piperazine-1-carboxylate |
| SMILES | COC(=O)c1ccc(NC/C=C/CNc2c(OCCCN3CCN(C(=O)OC(C)(C)C)CC3)cc(C(N)=O)cc2[N+](=O)[O-])c(N)c1 |
| InChI | InChI=1S/C31H43N7O8/c1-31(2,3)46-30(41)37-15-13-36(14-16-37)12-7-17-45-26-20-22(28(33)39)19-25(38(42)43)27(26)35-11-6-5-10-34-24-9-8-21(18-23(24)32)29(40)44-4/h5-6,8-9,18-20,34-35H,7,10-17,32H2,1-4H3,(H2,33,39)/b6-5+ |
| InChIKey | LKKBBJSUOHHBEV-AATRIKPKSA-N |
| XLogP | 3.46 |
| TPSA | 204.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.73 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|