C26H35N7O10S — CID 170571335
tert-butyl N-[3-[5-carbamoyl-3-nitro-2-[[(E)-4-(2-nitro-4-sulfamoylanilino)but-2-enyl]amino]phenoxy]propyl]-N-methylcarbamate (PubChem CID 170571335) has the molecular formula C26H35N7O10S and a molecular weight of 637.67 g/mol. Its IUPAC name is tert-butyl N-[3-[5-carbamoyl-3-nitro-2-[[(E)-4-(2-nitro-4-sulfamoylanilino)but-2-enyl]amino]phenoxy]propyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[3-[5-carbamoyl-3-nitro-2-[[(E)-4-(2-nitro-4-sulfamoylanilino)but-2-enyl]amino]phenoxy]propyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 170571335 |
| Molecular Formula | C26H35N7O10S |
| Molecular Weight | 637.67 g/mol |
| Exact Mass | 637.22 |
| IUPAC Name | tert-butyl N-[3-[5-carbamoyl-3-nitro-2-[[(E)-4-(2-nitro-4-sulfamoylanilino)but-2-enyl]amino]phenoxy]propyl]-N-methylcarbamate |
| SMILES | CN(CCCOc1cc(C(N)=O)cc([N+](=O)[O-])c1NC/C=C/CNc1ccc(S(N)(=O)=O)cc1[N+](=O)[O-])C(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H35N7O10S/c1-26(2,3)43-25(35)31(4)12-7-13-42-22-15-17(24(27)34)14-21(33(38)39)23(22)30-11-6-5-10-29-19-9-8-18(44(28,40)41)16-20(19)32(36)37/h5-6,8-9,14-16,29-30H,7,10-13H2,1-4H3,(H2,27,34)(H2,28,40,41)/b6-5+ |
| InChIKey | IGTQVWMEUMAVKU-AATRIKPKSA-N |
| XLogP | 2.97 |
| TPSA | 252.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.67 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|