C15H22N4O5 — CID 144847524
tert-butyl N-[2-(5-amino-4-methanimidoyl-2-nitrophenoxy)ethyl]-N-methylcarbamate (PubChem CID 144847524) has the molecular formula C15H22N4O5 and a molecular weight of 338.36 g/mol. Its IUPAC name is tert-butyl N-[2-(5-amino-4-methanimidoyl-2-nitrophenoxy)ethyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-(5-amino-4-methanimidoyl-2-nitrophenoxy)ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 144847524 |
| Molecular Formula | C15H22N4O5 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | tert-butyl N-[2-(5-amino-4-methanimidoyl-2-nitrophenoxy)ethyl]-N-methylcarbamate |
| SMILES | [H]/N=C/c1cc([N+](=O)[O-])c(OCCN(C)C(=O)OC(C)(C)C)cc1N |
| InChI | InChI=1S/C15H22N4O5/c1-15(2,3)24-14(20)18(4)5-6-23-13-8-11(17)10(9-16)7-12(13)19(21)22/h7-9,16H,5-6,17H2,1-4H3/b16-9+ |
| InChIKey | YRGUVUCBJVXDPI-CXUHLZMHSA-N |
| XLogP | 2.42 |
| TPSA | 131.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|