C32H42ClN9O10S — CID 158674234
tert-butyl N-[2-[(2-amino-[1,3]thiazolo[5,4-b]pyridin-5-yl)oxy]ethyl]-N-methylcarbamate;tert-butyl N-methyl-N-[2-[(5-nitro-2-pyridinyl)oxy]ethyl]carbamate;2-chloro-5-nitropyridine (PubChem CID 158674234) has the molecular formula C32H42ClN9O10S and a molecular weight of 780.26 g/mol. Its IUPAC name is tert-butyl N-[2-[(2-amino-[1,3]thiazolo[5,4-b]pyridin-5-yl)oxy]ethyl]-N-methylcarbamate;tert-butyl N-methyl-N-[2-[(5-nitro-2-pyridinyl)oxy]ethyl]carbamate;2-chloro-5-nitropyridine.
| Compound Name | tert-butyl N-[2-[(2-amino-[1,3]thiazolo[5,4-b]pyridin-5-yl)oxy]ethyl]-N-methylcarbamate;tert-butyl N-methyl-N-[2-[(5-nitro-2-pyridinyl)oxy]ethyl]carbamate;2-chloro-5-nitropyridine |
|---|---|
| PubChem CID | 158674234 |
| Molecular Formula | C32H42ClN9O10S |
| Molecular Weight | 780.26 g/mol |
| Exact Mass | 779.25 |
| IUPAC Name | tert-butyl N-[2-[(2-amino-[1,3]thiazolo[5,4-b]pyridin-5-yl)oxy]ethyl]-N-methylcarbamate;tert-butyl N-methyl-N-[2-[(5-nitro-2-pyridinyl)oxy]ethyl]carbamate;2-chloro-5-nitropyridine |
| SMILES | CN(CCOc1ccc([N+](=O)[O-])cn1)C(=O)OC(C)(C)C.CN(CCOc1ccc2nc(N)sc2n1)C(=O)OC(C)(C)C.O=[N+]([O-])c1ccc(Cl)nc1 |
| InChI | InChI=1S/C14H20N4O3S.C13H19N3O5.C5H3ClN2O2/c1-14(2,3)21-13(19)18(4)7-8-20-10-6-5-9-11(17-10)22-12(15)16-9;1-13(2,3)21-12(17)15(4)7-8-20-11-6-5-10(9-14-11)16(18)19;6-5-2-1-4(3-7-5)8(9)10/h5-6H,7-8H2,1-4H3,(H2,15,16);5-6,9H,7-8H2,1-4H3;1-3H |
| InChIKey | IEHXLPWESSINDR-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 241.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.26 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|