C19H31N3O5 — CID 156694765
tert-butyl N-methyl-N-[2-[[5-nitro-4,6-di(propan-2-yl)-2-pyridinyl]oxy]ethyl]carbamate (PubChem CID 156694765) has the molecular formula C19H31N3O5 and a molecular weight of 381.47 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[2-[[5-nitro-4,6-di(propan-2-yl)-2-pyridinyl]oxy]ethyl]carbamate.
| Compound Name | tert-butyl N-methyl-N-[2-[[5-nitro-4,6-di(propan-2-yl)-2-pyridinyl]oxy]ethyl]carbamate |
|---|---|
| PubChem CID | 156694765 |
| Molecular Formula | C19H31N3O5 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | tert-butyl N-methyl-N-[2-[[5-nitro-4,6-di(propan-2-yl)-2-pyridinyl]oxy]ethyl]carbamate |
| SMILES | CC(C)c1cc(OCCN(C)C(=O)OC(C)(C)C)nc(C(C)C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C19H31N3O5/c1-12(2)14-11-15(20-16(13(3)4)17(14)22(24)25)26-10-9-21(8)18(23)27-19(5,6)7/h11-13H,9-10H2,1-8H3 |
| InChIKey | BZWKNZPCPHYPGZ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 94.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|