C14H19BrClNO3 — CID 123463013
tert-butyl N-[2-(3-bromo-5-chlorophenoxy)ethyl]-N-methylcarbamate (PubChem CID 123463013) has the molecular formula C14H19BrClNO3 and a molecular weight of 364.67 g/mol. Its IUPAC name is tert-butyl N-[2-(3-bromo-5-chlorophenoxy)ethyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-(3-bromo-5-chlorophenoxy)ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 123463013 |
| Molecular Formula | C14H19BrClNO3 |
| Molecular Weight | 364.67 g/mol |
| Exact Mass | 363.02 |
| IUPAC Name | tert-butyl N-[2-(3-bromo-5-chlorophenoxy)ethyl]-N-methylcarbamate |
| SMILES | CN(CCOc1cc(Cl)cc(Br)c1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H19BrClNO3/c1-14(2,3)20-13(18)17(4)5-6-19-12-8-10(15)7-11(16)9-12/h7-9H,5-6H2,1-4H3 |
| InChIKey | YSSXRIAZIRDSCI-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.67 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |