C16H24BrNO4 — CID 118974939
tert-butyl N-[3-(3-bromo-5-methylphenoxy)-2-hydroxypropyl]-N-methylcarbamate (PubChem CID 118974939) has the molecular formula C16H24BrNO4 and a molecular weight of 374.28 g/mol. Its IUPAC name is tert-butyl N-[3-(3-bromo-5-methylphenoxy)-2-hydroxypropyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[3-(3-bromo-5-methylphenoxy)-2-hydroxypropyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 118974939 |
| Molecular Formula | C16H24BrNO4 |
| Molecular Weight | 374.28 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | tert-butyl N-[3-(3-bromo-5-methylphenoxy)-2-hydroxypropyl]-N-methylcarbamate |
| SMILES | Cc1cc(Br)cc(OCC(O)CN(C)C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C16H24BrNO4/c1-11-6-12(17)8-14(7-11)21-10-13(19)9-18(5)15(20)22-16(2,3)4/h6-8,13,19H,9-10H2,1-5H3 |
| InChIKey | XPCFWDAKSUORQK-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.28 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |