C21H26BrNO2 — CID 143373859
tert-butyl N-[2-(4-bromophenyl)-2-(4-methylphenyl)ethyl]-N-methylcarbamate (PubChem CID 143373859) has the molecular formula C21H26BrNO2 and a molecular weight of 404.35 g/mol. Its IUPAC name is tert-butyl N-[2-(4-bromophenyl)-2-(4-methylphenyl)ethyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-(4-bromophenyl)-2-(4-methylphenyl)ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 143373859 |
| Molecular Formula | C21H26BrNO2 |
| Molecular Weight | 404.35 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | tert-butyl N-[2-(4-bromophenyl)-2-(4-methylphenyl)ethyl]-N-methylcarbamate |
| SMILES | Cc1ccc(C(CN(C)C(=O)OC(C)(C)C)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C21H26BrNO2/c1-15-6-8-16(9-7-15)19(17-10-12-18(22)13-11-17)14-23(5)20(24)25-21(2,3)4/h6-13,19H,14H2,1-5H3 |
| InChIKey | LSRMUVXRIXBCBI-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.35 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |