C15H19BrF3NO3 — CID 67294198
tert-butyl N-[2-[4-bromo-2-(trifluoromethyl)phenoxy]ethyl]-N-methylcarbamate (PubChem CID 67294198) has the molecular formula C15H19BrF3NO3 and a molecular weight of 398.22 g/mol. Its IUPAC name is tert-butyl N-[2-[4-bromo-2-(trifluoromethyl)phenoxy]ethyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-[4-bromo-2-(trifluoromethyl)phenoxy]ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 67294198 |
| Molecular Formula | C15H19BrF3NO3 |
| Molecular Weight | 398.22 g/mol |
| Exact Mass | 397.05 |
| IUPAC Name | tert-butyl N-[2-[4-bromo-2-(trifluoromethyl)phenoxy]ethyl]-N-methylcarbamate |
| SMILES | CN(CCOc1ccc(Br)cc1C(F)(F)F)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H19BrF3NO3/c1-14(2,3)23-13(21)20(4)7-8-22-12-6-5-10(16)9-11(12)15(17,18)19/h5-6,9H,7-8H2,1-4H3 |
| InChIKey | JGKFUCWTCRMZMY-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.22 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |