C21H25F3N2O4 — CID 59334363
tert-butyl N-[2-[2-[(3-amino-4-fluorophenoxy)methyl]-3,4-difluorophenoxy]ethyl]-N-methylcarbamate (PubChem CID 59334363) has the molecular formula C21H25F3N2O4 and a molecular weight of 426.44 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[(3-amino-4-fluorophenoxy)methyl]-3,4-difluorophenoxy]ethyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-[2-[(3-amino-4-fluorophenoxy)methyl]-3,4-difluorophenoxy]ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 59334363 |
| Molecular Formula | C21H25F3N2O4 |
| Molecular Weight | 426.44 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | tert-butyl N-[2-[2-[(3-amino-4-fluorophenoxy)methyl]-3,4-difluorophenoxy]ethyl]-N-methylcarbamate |
| SMILES | CN(CCOc1ccc(F)c(F)c1COc1ccc(F)c(N)c1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H25F3N2O4/c1-21(2,3)30-20(27)26(4)9-10-28-18-8-7-16(23)19(24)14(18)12-29-13-5-6-15(22)17(25)11-13/h5-8,11H,9-10,12,25H2,1-4H3 |
| InChIKey | FBZZBPNMLKKAFA-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.44 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|