C15H19F2NO4 — CID 157021850
tert-butyl N-[2-(2,5-difluoro-4-formylphenoxy)ethyl]-N-methylcarbamate (PubChem CID 157021850) has the molecular formula C15H19F2NO4 and a molecular weight of 315.32 g/mol. Its IUPAC name is tert-butyl N-[2-(2,5-difluoro-4-formylphenoxy)ethyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-(2,5-difluoro-4-formylphenoxy)ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 157021850 |
| Molecular Formula | C15H19F2NO4 |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | tert-butyl N-[2-(2,5-difluoro-4-formylphenoxy)ethyl]-N-methylcarbamate |
| SMILES | CN(CCOc1cc(F)c(C=O)cc1F)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H19F2NO4/c1-15(2,3)22-14(20)18(4)5-6-21-13-8-11(16)10(9-19)7-12(13)17/h7-9H,5-6H2,1-4H3 |
| InChIKey | ZNBXJVSAWASPOQ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|