C31H50N4O10 — CID 58108843
tert-butyl N-[2-[4-isocyanato-2,6-bis[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethoxy]phenoxy]ethyl]-N-methylcarbamate (PubChem CID 58108843) has the molecular formula C31H50N4O10 and a molecular weight of 638.76 g/mol. Its IUPAC name is tert-butyl N-[2-[4-isocyanato-2,6-bis[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethoxy]phenoxy]ethyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-[4-isocyanato-2,6-bis[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethoxy]phenoxy]ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 58108843 |
| Molecular Formula | C31H50N4O10 |
| Molecular Weight | 638.76 g/mol |
| Exact Mass | 638.35 |
| IUPAC Name | tert-butyl N-[2-[4-isocyanato-2,6-bis[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethoxy]phenoxy]ethyl]-N-methylcarbamate |
| SMILES | CN(CCOc1cc(N=C=O)cc(OCCN(C)C(=O)OC(C)(C)C)c1OCCN(C)C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C31H50N4O10/c1-29(2,3)43-26(37)33(10)13-16-40-23-19-22(32-21-36)20-24(41-17-14-34(11)27(38)44-30(4,5)6)25(23)42-18-15-35(12)28(39)45-31(7,8)9/h19-20H,13-18H2,1-12H3 |
| InChIKey | WKCVBEBYDXQNBH-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 145.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.76 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|