C14H19BrFNO3 — CID 139317833
tert-butyl N-[2-(4-bromo-3-fluorophenoxy)ethyl]-N-methylcarbamate (PubChem CID 139317833) has the molecular formula C14H19BrFNO3 and a molecular weight of 348.21 g/mol. Its IUPAC name is tert-butyl N-[2-(4-bromo-3-fluorophenoxy)ethyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-(4-bromo-3-fluorophenoxy)ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 139317833 |
| Molecular Formula | C14H19BrFNO3 |
| Molecular Weight | 348.21 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | tert-butyl N-[2-(4-bromo-3-fluorophenoxy)ethyl]-N-methylcarbamate |
| SMILES | CN(CCOc1ccc(Br)c(F)c1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H19BrFNO3/c1-14(2,3)20-13(18)17(4)7-8-19-10-5-6-11(15)12(16)9-10/h5-6,9H,7-8H2,1-4H3 |
| InChIKey | UOWVGGMZPROLFG-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.21 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |