C22H27BrFNO3 — CID 138734294
tert-butyl N-[3-[[2-(4-bromo-3-fluorophenyl)phenyl]methoxy]propyl]-N-methylcarbamate (PubChem CID 138734294) has the molecular formula C22H27BrFNO3 and a molecular weight of 452.36 g/mol. Its IUPAC name is tert-butyl N-[3-[[2-(4-bromo-3-fluorophenyl)phenyl]methoxy]propyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[3-[[2-(4-bromo-3-fluorophenyl)phenyl]methoxy]propyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 138734294 |
| Molecular Formula | C22H27BrFNO3 |
| Molecular Weight | 452.36 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | tert-butyl N-[3-[[2-(4-bromo-3-fluorophenyl)phenyl]methoxy]propyl]-N-methylcarbamate |
| SMILES | CN(CCCOCc1ccccc1-c1ccc(Br)c(F)c1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H27BrFNO3/c1-22(2,3)28-21(26)25(4)12-7-13-27-15-17-8-5-6-9-18(17)16-10-11-19(23)20(24)14-16/h5-6,8-11,14H,7,12-13,15H2,1-4H3 |
| InChIKey | JWNCNXOMWJKBCR-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.36 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|