C19H21ClFNO3 — CID 172890587
tert-butyl N-[[2-(3-chloro-5-fluoro-4-hydroxyphenyl)phenyl]methyl]-N-methylcarbamate (PubChem CID 172890587) has the molecular formula C19H21ClFNO3 and a molecular weight of 365.83 g/mol. Its IUPAC name is tert-butyl N-[[2-(3-chloro-5-fluoro-4-hydroxyphenyl)phenyl]methyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[[2-(3-chloro-5-fluoro-4-hydroxyphenyl)phenyl]methyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 172890587 |
| Molecular Formula | C19H21ClFNO3 |
| Molecular Weight | 365.83 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | tert-butyl N-[[2-(3-chloro-5-fluoro-4-hydroxyphenyl)phenyl]methyl]-N-methylcarbamate |
| SMILES | CN(Cc1ccccc1-c1cc(F)c(O)c(Cl)c1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H21ClFNO3/c1-19(2,3)25-18(24)22(4)11-12-7-5-6-8-14(12)13-9-15(20)17(23)16(21)10-13/h5-10,23H,11H2,1-4H3 |
| InChIKey | ZSCRNXHSDIWLRL-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.83 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |