C14H17FN2O3 — CID 140759326
tert-butyl N-[(2-fluoro-5-hydroxy-3-isocyanophenyl)methyl]-N-methylcarbamate (PubChem CID 140759326) has the molecular formula C14H17FN2O3 and a molecular weight of 280.30 g/mol. Its IUPAC name is tert-butyl N-[(2-fluoro-5-hydroxy-3-isocyanophenyl)methyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[(2-fluoro-5-hydroxy-3-isocyanophenyl)methyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 140759326 |
| Molecular Formula | C14H17FN2O3 |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | tert-butyl N-[(2-fluoro-5-hydroxy-3-isocyanophenyl)methyl]-N-methylcarbamate |
| SMILES | [C-]#[N+]c1cc(O)cc(CN(C)C(=O)OC(C)(C)C)c1F |
| InChI | InChI=1S/C14H17FN2O3/c1-14(2,3)20-13(19)17(5)8-9-6-10(18)7-11(16-4)12(9)15/h6-7,18H,8H2,1-3,5H3 |
| InChIKey | KWBSLNZMLPEABT-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 54.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|