C14H19F3N2O3 — CID 59315399
tert-butyl N-[[5-amino-2-(trifluoromethoxy)phenyl]methyl]-N-methylcarbamate (PubChem CID 59315399) has the molecular formula C14H19F3N2O3 and a molecular weight of 320.31 g/mol. Its IUPAC name is tert-butyl N-[[5-amino-2-(trifluoromethoxy)phenyl]methyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[[5-amino-2-(trifluoromethoxy)phenyl]methyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 59315399 |
| Molecular Formula | C14H19F3N2O3 |
| Molecular Weight | 320.31 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | tert-butyl N-[[5-amino-2-(trifluoromethoxy)phenyl]methyl]-N-methylcarbamate |
| SMILES | CN(Cc1cc(N)ccc1OC(F)(F)F)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H19F3N2O3/c1-13(2,3)22-12(20)19(4)8-9-7-10(18)5-6-11(9)21-14(15,16)17/h5-7H,8,18H2,1-4H3 |
| InChIKey | PNPNOJCZPNCMHX-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.31 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|