C17H27FN2O4 — CID 118101215
tert-butyl N-[[5-amino-3-fluoro-2-(3-methoxypropoxy)phenyl]methyl]-N-methylcarbamate (PubChem CID 118101215) has the molecular formula C17H27FN2O4 and a molecular weight of 342.41 g/mol. Its IUPAC name is tert-butyl N-[[5-amino-3-fluoro-2-(3-methoxypropoxy)phenyl]methyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[[5-amino-3-fluoro-2-(3-methoxypropoxy)phenyl]methyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 118101215 |
| Molecular Formula | C17H27FN2O4 |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | tert-butyl N-[[5-amino-3-fluoro-2-(3-methoxypropoxy)phenyl]methyl]-N-methylcarbamate |
| SMILES | COCCCOc1c(F)cc(N)cc1CN(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H27FN2O4/c1-17(2,3)24-16(21)20(4)11-12-9-13(19)10-14(18)15(12)23-8-6-7-22-5/h9-10H,6-8,11,19H2,1-5H3 |
| InChIKey | PKKHAIDSPSXDMN-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|