C13H19IN2O2S — CID 89133118
tert-butyl N-[(5-amino-2-iodosulfanylphenyl)methyl]-N-methylcarbamate (PubChem CID 89133118) has the molecular formula C13H19IN2O2S and a molecular weight of 394.28 g/mol. Its IUPAC name is tert-butyl N-[(5-amino-2-iodosulfanylphenyl)methyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[(5-amino-2-iodosulfanylphenyl)methyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 89133118 |
| Molecular Formula | C13H19IN2O2S |
| Molecular Weight | 394.28 g/mol |
| Exact Mass | 394.02 |
| IUPAC Name | tert-butyl N-[(5-amino-2-iodosulfanylphenyl)methyl]-N-methylcarbamate |
| SMILES | CN(Cc1cc(N)ccc1SI)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H19IN2O2S/c1-13(2,3)18-12(17)16(4)8-9-7-10(15)5-6-11(9)19-14/h5-7H,8,15H2,1-4H3 |
| InChIKey | ZKNYNLFNWSFPTO-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.28 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|