C16H22N4O2 — CID 123235376
tert-butyl N-[[2-amino-3-(1H-pyrazol-5-yl)phenyl]methyl]-N-methylcarbamate (PubChem CID 123235376) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is tert-butyl N-[[2-amino-3-(1H-pyrazol-5-yl)phenyl]methyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[[2-amino-3-(1H-pyrazol-5-yl)phenyl]methyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 123235376 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | tert-butyl N-[[2-amino-3-(1H-pyrazol-5-yl)phenyl]methyl]-N-methylcarbamate |
| SMILES | CN(Cc1cccc(-c2ccn[nH]2)c1N)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H22N4O2/c1-16(2,3)22-15(21)20(4)10-11-6-5-7-12(14(11)17)13-8-9-18-19-13/h5-9H,10,17H2,1-4H3,(H,18,19) |
| InChIKey | LUKOUYJAHBFDQH-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|