C25H28N2O6S2 — CID 25180911
tert-butyl N-[[2-[bis(benzenesulfonyl)amino]phenyl]methyl]-N-methylcarbamate (PubChem CID 25180911) has the molecular formula C25H28N2O6S2 and a molecular weight of 516.64 g/mol. Its IUPAC name is tert-butyl N-[[2-[bis(benzenesulfonyl)amino]phenyl]methyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[[2-[bis(benzenesulfonyl)amino]phenyl]methyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 25180911 |
| Molecular Formula | C25H28N2O6S2 |
| Molecular Weight | 516.64 g/mol |
| Exact Mass | 516.14 |
| IUPAC Name | tert-butyl N-[[2-[bis(benzenesulfonyl)amino]phenyl]methyl]-N-methylcarbamate |
| SMILES | CN(Cc1ccccc1N(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H28N2O6S2/c1-25(2,3)33-24(28)26(4)19-20-13-11-12-18-23(20)27(34(29,30)21-14-7-5-8-15-21)35(31,32)22-16-9-6-10-17-22/h5-18H,19H2,1-4H3 |
| InChIKey | JBOPKIPTEPLIDI-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.64 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |