C15H24N2O4S — CID 110315307
tert-butyl N-[(2S)-1-[benzenesulfonyl(methyl)amino]propan-2-yl]carbamate (PubChem CID 110315307) has the molecular formula C15H24N2O4S and a molecular weight of 328.43 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[benzenesulfonyl(methyl)amino]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[benzenesulfonyl(methyl)amino]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 110315307 |
| Molecular Formula | C15H24N2O4S |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | tert-butyl N-[(2S)-1-[benzenesulfonyl(methyl)amino]propan-2-yl]carbamate |
| SMILES | C[C@@H](CN(C)S(=O)(=O)c1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H24N2O4S/c1-12(16-14(18)21-15(2,3)4)11-17(5)22(19,20)13-9-7-6-8-10-13/h6-10,12H,11H2,1-5H3,(H,16,18)/t12-/m0/s1 |
| InChIKey | NFRSGCXQKQKGMX-LBPRGKRZSA-N |
| XLogP | 2.22 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |